1,3-Dioxolane-2,2-dipropanoicacid, 2,2-diethyl ester structure
|
Common Name | 1,3-Dioxolane-2,2-dipropanoicacid, 2,2-diethyl ester | ||
|---|---|---|---|---|
| CAS Number | 19719-88-1 | Molecular Weight | 274.31000 | |
| Density | 1.095g/cm3 | Boiling Point | 333.1ºC at 760mmHg | |
| Molecular Formula | C13H22O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 142.6ºC | |
| Name | ethyl 3-[2-(3-ethoxy-3-oxopropyl)-1,3-dioxolan-2-yl]propanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.095g/cm3 |
|---|---|
| Boiling Point | 333.1ºC at 760mmHg |
| Molecular Formula | C13H22O6 |
| Molecular Weight | 274.31000 |
| Flash Point | 142.6ºC |
| Exact Mass | 274.14200 |
| PSA | 71.06000 |
| LogP | 1.41610 |
| Vapour Pressure | 0.00014mmHg at 25°C |
| Index of Refraction | 1.447 |
| InChIKey | ONUYCNWYOZCURQ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CCC1(CCC(=O)OCC)OCCO1 |
| diethyl 4,4-(ethylenedioxy)pimelate |
| ethyl 3-<2-<2-(ethoxycarbonyl)ethyl><1,3>dioxolan-2-yl>propionate |
| 1,3-Dioxolane-2,2-dipropanoic acid,diethyl ester |
| ethylene ketal of diethyl 4-oxopimelate |
| diethyl 3,3'-(1,3-dioxolane-2,2-diyl)dipropanoate |
| 4,4-(Ethylendioxy)-heptandisaeure-diethylester |