Diethyl 4-oxoheptanedioate structure
|
Common Name | Diethyl 4-oxoheptanedioate | ||
|---|---|---|---|---|
| CAS Number | 6317-49-3 | Molecular Weight | 230.258 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 318.5±17.0 °C at 760 mmHg | |
| Molecular Formula | C11H18O5 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 137.4±21.0 °C | |
| Name | Diethyl 4-oxoheptanedioate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 318.5±17.0 °C at 760 mmHg |
| Molecular Formula | C11H18O5 |
| Molecular Weight | 230.258 |
| Flash Point | 137.4±21.0 °C |
| Exact Mass | 230.115417 |
| PSA | 69.67000 |
| LogP | 0.96 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.441 |
| InChIKey | ZGBUXZJMZBBISR-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CCC(=O)CCC(=O)OCC |
| Personal Protective Equipment | Eyeshields;Gloves |
|---|---|
| Safety Phrases | S23-S24/25 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2918300090 |
| Precursor 9 | |
|---|---|
| DownStream 10 | |
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| Diethyl γ-ketopimelate |
| Diethyl 4-oxoheptanedioate |
| Heptanedioic acid, 4-oxo-, diethyl ester |
| MFCD00009210 |
| EINECS 228-657-0 |