1,8,8-TRIMETHYL-3-AZA-BICYCLO[3.2.1]OCTANE-2,4-DIONE structure
|
Common Name | 1,8,8-TRIMETHYL-3-AZA-BICYCLO[3.2.1]OCTANE-2,4-DIONE | ||
|---|---|---|---|---|
| CAS Number | 1972-03-8 | Molecular Weight | 181.23200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H15NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5,8,8-trimethyl-3-azabicyclo[3.2.1]octane-2,4-dione |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H15NO2 |
|---|---|
| Molecular Weight | 181.23200 |
| Exact Mass | 181.11000 |
| PSA | 49.66000 |
| LogP | 1.36120 |
| Vapour Pressure | 0.00109mmHg at 25°C |
| InChIKey | NRQVXWNPFZZDMQ-UHFFFAOYSA-N |
| SMILES | CC12CCC(C(=O)NC1=O)C2(C)C |
| HS Code | 2925190090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 2 | |
| HS Code | 2925190090 |
|---|---|
| Summary | 2925190090 other imides and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|
Name: Screen for inhibitors of RMI FANCM (MM2) intereaction
Source: 11908
Target: N/A
External Id: RMI-FANCM-MM2
|
|
Name: Inhibitors of CDC25B-CDK2/CyclinA interaction
Source: Center for Chemical Genomics, University of Michigan
External Id: MScreen:TargetID_600
|
| camphorimide |
| bb_sc-2603 |