4-(4-formyl-3,5-dimethoxyphenoxy)butyric acid structure
|
Common Name | 4-(4-formyl-3,5-dimethoxyphenoxy)butyric acid | ||
|---|---|---|---|---|
| CAS Number | 197304-21-5 | Molecular Weight | 268.26300 | |
| Density | 1.234g/cm3 | Boiling Point | 492.3ºC at 760mmHg | |
| Molecular Formula | C13H16O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 187.8ºC | |
| Name | 4-(4-formyl-3,5-dimethoxyphenoxy)butanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.234g/cm3 |
|---|---|
| Boiling Point | 492.3ºC at 760mmHg |
| Molecular Formula | C13H16O6 |
| Molecular Weight | 268.26300 |
| Flash Point | 187.8ºC |
| Exact Mass | 268.09500 |
| PSA | 82.06000 |
| LogP | 1.75990 |
| Vapour Pressure | 1.65E-10mmHg at 25°C |
| Index of Refraction | 1.543 |
| InChIKey | SEJSVFHBVLKHLB-UHFFFAOYSA-N |
| SMILES | COc1cc(OCCCC(=O)O)cc(OC)c1C=O |
| Storage condition | Store at 0-5°C |
| Hazard Codes | Xi |
|---|---|
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26-36/37/39-27 |
| HS Code | 2918990090 |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| AmbotzRL-1072 |
| MFCD01317805 |