Phosphonium,(2-oxobutyl)triphenyl-, chloride (1:1) structure
|
Common Name | Phosphonium,(2-oxobutyl)triphenyl-, chloride (1:1) | ||
|---|---|---|---|---|
| CAS Number | 19753-61-8 | Molecular Weight | 368.83600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H22ClOP | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-oxobutyl(triphenyl)phosphanium |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C22H22ClOP |
|---|---|
| Molecular Weight | 368.83600 |
| Exact Mass | 368.11000 |
| PSA | 30.66000 |
| LogP | 0.96360 |
| InChIKey | KGEZBLKGIWBODU-UHFFFAOYSA-N |
| SMILES | CCC(=O)C[P+](c1ccccc1)(c1ccccc1)c1ccccc1 |
|
~%
Phosphonium,(2-... CAS#:19753-61-8 |
| Literature: Nader,B.; Bailey,T.R.; Franck,R.W. Journal of the American Chemical Society, 1981 , vol. 103, p. 7573 |
|
~%
Phosphonium,(2-... CAS#:19753-61-8 |
| Literature: Issleib,K.; Lindner,R. Justus Liebigs Annalen der Chemie, 1968 , vol. 713, p. 12 - 29 |
| <2-Oxo-butyl>-triphenylphosphoniumchlorid |
| Phosphonium,(2-oxobutyl)triphenyl-,chloride (8CI,9CI) |
| Phosphonium,(2-oxobutyl)triphenyl-,chloride (1:1) |
| 1-(Triphenylphosphoranyl)-2-butanone |