Methyltriphenylphosphonium bromide structure
|
Common Name | Methyltriphenylphosphonium bromide | ||
|---|---|---|---|---|
| CAS Number | 1779-49-3 | Molecular Weight | 357.224 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H18BrP | Melting Point | 230-234 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | >240°C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | Methyltriphenylphosphonium bromide |
|---|---|
| Synonym | More Synonyms |
| Melting Point | 230-234 °C(lit.) |
|---|---|
| Molecular Formula | C19H18BrP |
| Molecular Weight | 357.224 |
| Flash Point | >240°C |
| Exact Mass | 356.032928 |
| PSA | 13.59000 |
| LogP | 0.61430 |
| InChIKey | LSEFCHWGJNHZNT-UHFFFAOYSA-M |
| SMILES | C[P+](c1ccccc1)(c1ccccc1)c1ccccc1.[Br-] |
| Storage condition | 2-8°C |
| Water Solubility | 400 g/L (25 ºC) |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302 + H312 + H332 |
| Precautionary Statements | P280 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xn:Harmful |
| Risk Phrases | R20/21/22 |
| Safety Phrases | S36/37 |
| RIDADR | UN 1390 4.3/PG 2 |
| WGK Germany | 3 |
| Packaging Group | III |
| Hazard Class | 6.1 |
| HS Code | 29310095 |
| Precursor 8 | |
|---|---|
| DownStream 10 | |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
|
Understanding channel blocking in the nicotinic acetylcholine receptor.
Receptors Channels 7(4) , 273-88, (2001) Ion-channel blockers are molecules that obstruct the path used by ions to cross the membrane through a protein channel. Many of these are local anesthetics, toxins or drugs of abuse, and the knowledge... |
|
|
Simultaneous extraction of flavonoids from Chamaecyparis obtusa using deep eutectic solvents as additives of conventional extractions solvents.
J. Chromatogr. Sci. 53 , 836-40, (2015) Three flavones (quercetin, myricetin and amentoflavone) were extracted from Chamaecyparis obtusa leaves using deep eutectic solvents (DESs) as additives to conventional extractions solvents. Sixteen D... |
|
|
Primary causes of decreased mitochondrial oxygen consumption during metabolic depression in snail cells.
Am. J. Physiol. Regul. Integr. Comp. Physiol. 282(2) , R372-82, (2002) Cells isolated from the hepatopancreas of estivating snails (Helix aspersa) have strongly depressed mitochondrial respiration compared with controls. Mitochondrial respiration was divided into substra... |
| Methyl triphenyl pho |
| Mettler-Toledo Calibration substance ME 30130598,Methyltriphenylphosphoniumbromide |
| Methyl (triphenyl)phosphonium bromide |
| methyltriphenylphosphonium bromid |
| Phosphonium,methyltriphenyl-,bromide |
| Methyl(triphenyl)phosphonium bromide |
| Methyl triphenyl phosphonium bromide |
| Methy triphenylphosphonium |
| Phosphonium, methyltriphenyl-, bromide |
| Methyl triphenylphosphonium bromide |
| Triphenylmethylphosphonium Bromide |
| Methyltriphenylphosphanium bromide |
| methyltriphenyl-phosphoniubromide |
| Methyltriphenylphosphine bromide |
| EINECS 217-218-9 |
| MFCD00011804 |
| Phosphonium, methyltriphenyl-, bromide (1:1) |
| Methyltriphenyl phosphorniuM broMide |
| Methyltriphenylphosphonium bromide |