2-amino-3-(2,4-dioxo-3,4-dihydro-2h-pyrimidin-1-yl)-propionic acid structure
|
Common Name | 2-amino-3-(2,4-dioxo-3,4-dihydro-2h-pyrimidin-1-yl)-propionic acid | ||
|---|---|---|---|---|
| CAS Number | 19772-76-0 | Molecular Weight | 199.16400 | |
| Density | 1.501g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C7H9N3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-amino-3-(2,4-dioxo-3,4-dihydro-2h-pyrimidin-1-yl)-propionic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.501g/cm3 |
|---|---|
| Molecular Formula | C7H9N3O4 |
| Molecular Weight | 199.16400 |
| Exact Mass | 199.05900 |
| PSA | 118.18000 |
| Index of Refraction | 1.581 |
| InChIKey | FACUYWPMDKTVFU-UHFFFAOYSA-N |
| SMILES | NC(Cn1ccc(=O)[nH]c1=O)C(=O)O |
| HS Code | 2933599090 |
|---|
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| N,N-didesmethyl venlafaxine hydrochloride |
| DDMV hydrochloride |
| didesmethylvenlafaxine hydrochloride |
| DL-willardiine |