tert-Butyl 4-[acetyl(Methyl)amino]piperidine-1-carboxylate structure
|
Common Name | tert-Butyl 4-[acetyl(Methyl)amino]piperidine-1-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 197727-57-4 | Molecular Weight | 256.34100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H24N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | tert-Butyl 4-[acetyl(methyl)amino]-piperidine-1-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H24N2O3 |
|---|---|
| Molecular Weight | 256.34100 |
| Exact Mass | 256.17900 |
| PSA | 49.85000 |
| LogP | 1.80210 |
| InChIKey | OTJULCBBAJJDGR-UHFFFAOYSA-N |
| SMILES | CC(=O)N(C)C1CCN(C(=O)OC(C)(C)C)CC1 |
| HS Code | 2933399090 |
|---|
|
~96%
tert-Butyl 4-[a... CAS#:197727-57-4 |
| Literature: VERNALIS (OXFORD) LIMITED; LABORATOIRES SERONO S.A. Patent: WO2005/19194 A1, 2005 ; Location in patent: Page/Page column 35 ; WO 2005/019194 A1 |
|
~50%
tert-Butyl 4-[a... CAS#:197727-57-4 |
| Literature: BOEHRINGER INGELHEIM INTERNATIONAL GmbH; BOEHRINGER INGELHEIM PHARMA GMBH and CO. KG Patent: WO2008/71646 A1, 2008 ; Location in patent: Page/Page column 79 ; WO 2008/071646 A1 |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| tert-butyl 4-[acetyl(methyl)amino]piperidine-1-carboxylate |