Peimisine structure
|
Common Name | Peimisine | ||
|---|---|---|---|---|
| CAS Number | 19773-24-1 | Molecular Weight | 427.619 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 573.0±50.0 °C at 760 mmHg | |
| Molecular Formula | C27H41NO3 | Melting Point | 270℃ | |
| MSDS | N/A | Flash Point | 300.3±30.1 °C | |
Use of PeimisinePeimisine(Ebeiensine) is a steroidal alkaloid which is the major biologically active component in Bulbus Fritillariae; possess a variety of toxicological and pharmacological effects on humans. |
| Name | peimisine |
|---|---|
| Synonym | More Synonyms |
| Description | Peimisine(Ebeiensine) is a steroidal alkaloid which is the major biologically active component in Bulbus Fritillariae; possess a variety of toxicological and pharmacological effects on humans. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 573.0±50.0 °C at 760 mmHg |
| Melting Point | 270℃ |
| Molecular Formula | C27H41NO3 |
| Molecular Weight | 427.619 |
| Flash Point | 300.3±30.1 °C |
| Exact Mass | 427.308655 |
| PSA | 58.56000 |
| LogP | 3.70 |
| Vapour Pressure | 0.0±3.6 mmHg at 25°C |
| Index of Refraction | 1.578 |
| InChIKey | KYELXPJVGNZIGC-GKFGJCLESA-N |
| SMILES | CC1=C2CC3C(CC(=O)C4CC(O)CCC43C)C2CCC12OC1CC(C)CNC1C2C |
| Storage condition | -20°C |
| Safety Phrases | 24/25 |
|---|
| (3β,5α,17β,22S,23R)-3-Hydroxy-5,6-dihydro-17,23-epoxyveratraman-6-one |
| Spiro[9H-benzo[a]fluorene-9,2'(3'H)-furo[3,2-b]pyridin]-5(6H)-one, 1,2,3,3'a,4,4',4a,5',6',6a,6b,7,7',7'a,8,11,11a,11b-octadecahydro-3-hydroxy-3',6',10,11b-tetramethyl-, (3S,3'R,3a'S,6'S,6aR,6bS,9R,11aS,11bR)- |
| Veratraman-6(5H)-one, 17,23-epoxy-3-hydroxy-, (3β)- |
| Spiro[9H-benzo[a]fluorene-9,2'(3'H)-furo[3,2-b]pyridin]-5(6H)-one, 1,2,3,3'a,4,4',4a,5',6',6a,6b,7,7',7'a,8,11,11a,11b-octadecahydro-3-hydroxy-3',6',10,11b-tetramethyl-, (3S,3'R,3a'S,4aS,6'S,6aR,6bS,7a'R,9R,11aS,11bR)- |
| (3β,22S)-3-Hydroxy-5,6-dihydro-17,23-epoxyveratraman-6-one |
| Veratraman-6(5H)-one, 17,23-epoxy-3-hydroxy-, (3β,5α,23β)- |
| (3β,5α,22S,23R)-3-Hydroxy-5,6-dihydro-17,23-epoxyveratraman-6-one |