1H-Isoindole-1,3(2H)-dione,4-nitro-2-(5-nitro-2-thiazolyl)- structure
|
Common Name | 1H-Isoindole-1,3(2H)-dione,4-nitro-2-(5-nitro-2-thiazolyl)- | ||
|---|---|---|---|---|
| CAS Number | 19783-57-4 | Molecular Weight | 320.23800 | |
| Density | 1.849g/cm3 | Boiling Point | 652.1ºC at 760mmHg | |
| Molecular Formula | C11H4N4O6S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 348.2ºC | |
| Name | 4-nitro-2-(5-nitro-1,3-thiazol-2-yl)isoindole-1,3-dione |
|---|
| Density | 1.849g/cm3 |
|---|---|
| Boiling Point | 652.1ºC at 760mmHg |
| Molecular Formula | C11H4N4O6S |
| Molecular Weight | 320.23800 |
| Flash Point | 348.2ºC |
| Exact Mass | 319.98500 |
| PSA | 170.15000 |
| LogP | 2.87150 |
| Vapour Pressure | 6.95E-17mmHg at 25°C |
| Index of Refraction | 1.765 |
| InChIKey | IBRHNSVYXAMUOS-UHFFFAOYSA-N |
| SMILES | O=C1c2cccc([N+](=O)[O-])c2C(=O)N1c1ncc([N+](=O)[O-])s1 |
|
~%
1H-Isoindole-1,... CAS#:19783-57-4 |
| Literature: Rice,L.M. et al. Journal of Medicinal Chemistry, 1968 , vol. 11, # 1 p. 183 - 185 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |