1,2,3,4,5-pentachloro-6-chlorosulfanyl-benzene structure
|
Common Name | 1,2,3,4,5-pentachloro-6-chlorosulfanyl-benzene | ||
|---|---|---|---|---|
| CAS Number | 19815-92-0 | Molecular Weight | 316.84700 | |
| Density | 1.84g/cm3 | Boiling Point | 400ºC at 760 mmHg | |
| Molecular Formula | C6Cl6S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 181.7ºC | |
| Name | Pentachlor-benzolsulfochlorid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.84g/cm3 |
|---|---|
| Boiling Point | 400ºC at 760 mmHg |
| Molecular Formula | C6Cl6S |
| Molecular Weight | 316.84700 |
| Flash Point | 181.7ºC |
| Exact Mass | 313.78500 |
| PSA | 25.30000 |
| LogP | 6.19950 |
| Vapour Pressure | 3.02E-06mmHg at 25°C |
| Index of Refraction | 1.666 |
| InChIKey | YVDBISQMWKWRBX-UHFFFAOYSA-N |
| SMILES | ClSc1c(Cl)c(Cl)c(Cl)c(Cl)c1Cl |
|
~%
1,2,3,4,5-penta... CAS#:19815-92-0 |
| Literature: Ponci,R. et al. Farmaco, Edizione Scientifica, 1964 , vol. 19, p. 489 - 505 |
|
~%
1,2,3,4,5-penta... CAS#:19815-92-0 |
| Literature: Glidewell,C.; Walton,J.C. Journal of the Chemical Society, Chemical Communications, 1977 , p. 915 - 916 |
| chloro-pentachlorophenyl-sulfane |
| Benzenesulfonyl chloride,pentachloro |
| pentachlorophenylsulphenyl chloride |
| Pentachlorbenzolsulfonsaeurechlorid |
| Pentachlor-benzolsulfenylchlorid |
| Pentachlor-benzolsulfonylchlorid |
| pentachlorobenzenesulphenyl chloride |
| pentachlorobenzenesulfenyl chloride |
| pentachloro-benzenesulfonyl chloride |