1,2,3,4,5-pentachloro-6-propoxybenzene structure
|
Common Name | 1,2,3,4,5-pentachloro-6-propoxybenzene | ||
|---|---|---|---|---|
| CAS Number | 36518-74-8 | Molecular Weight | 308.41600 | |
| Density | 1.495g/cm3 | Boiling Point | 349.5ºC at 760 mmHg | |
| Molecular Formula | C9H7Cl5O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 129.7ºC | |
| Name | 1,2,3,4,5-pentachloro-6-propoxybenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.495g/cm3 |
|---|---|
| Boiling Point | 349.5ºC at 760 mmHg |
| Molecular Formula | C9H7Cl5O |
| Molecular Weight | 308.41600 |
| Flash Point | 129.7ºC |
| Exact Mass | 305.89400 |
| PSA | 9.23000 |
| LogP | 5.74240 |
| Index of Refraction | 1.559 |
| InChIKey | GJMNJUGLIPUBHJ-UHFFFAOYSA-N |
| SMILES | CCCOc1c(Cl)c(Cl)c(Cl)c(Cl)c1Cl |
| HS Code | 2909309090 |
|---|
|
~%
1,2,3,4,5-penta... CAS#:36518-74-8 |
| Literature: Biltz; Giese Chemische Berichte, 1904 , vol. 37, p. 4016 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2909309090 |
|---|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| Benzene,pentachloropropoxy |
| Pentachlorphenyl-propylether |
| CP 293 |
| Pentachlorophenyl propyl ether |
| Pentachlorphenyl-propyl-aether |