N-(3,4-dichlorophenyl)furan-2-carboxamide structure
|
Common Name | N-(3,4-dichlorophenyl)furan-2-carboxamide | ||
|---|---|---|---|---|
| CAS Number | 1982-60-1 | Molecular Weight | 256.08500 | |
| Density | 1.463g/cm3 | Boiling Point | 278.4ºC at 760 mmHg | |
| Molecular Formula | C11H7Cl2NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 122.2ºC | |
| Name | N-(3,4-dichlorophenyl)furan-2-carboxamide |
|---|
| Density | 1.463g/cm3 |
|---|---|
| Boiling Point | 278.4ºC at 760 mmHg |
| Molecular Formula | C11H7Cl2NO2 |
| Molecular Weight | 256.08500 |
| Flash Point | 122.2ºC |
| Exact Mass | 254.98500 |
| PSA | 42.24000 |
| LogP | 3.91170 |
| Vapour Pressure | 0.00428mmHg at 25°C |
| Index of Refraction | 1.638 |
| InChIKey | WQXSBOMBIFWLFW-UHFFFAOYSA-N |
| SMILES | O=C(Nc1ccc(Cl)c(Cl)c1)c1ccco1 |
| HS Code | 2932190090 |
|---|
| HS Code | 2932190090 |
|---|---|
| Summary | 2932190090 other compounds containing an unfused furan ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |