N-(4-Chlorophenyl)-4-chlorobenzenemethanimine N-oxide structure
|
Common Name | N-(4-Chlorophenyl)-4-chlorobenzenemethanimine N-oxide | ||
|---|---|---|---|---|
| CAS Number | 19865-60-2 | Molecular Weight | 266.12300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H9Cl2NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N,1-bis(4-chlorophenyl)methanimine oxide |
|---|
| Molecular Formula | C13H9Cl2NO |
|---|---|
| Molecular Weight | 266.12300 |
| Exact Mass | 265.00600 |
| PSA | 28.75000 |
| LogP | 4.77750 |
| InChIKey | BDNNMZCBBQLBGB-UHFFFAOYSA-N |
| SMILES | [O-][N+](=Cc1ccc(Cl)cc1)c1ccc(Cl)cc1 |
|
~58%
N-(4-Chlorophen... CAS#:19865-60-2 |
| Literature: Jiao, Peng; Nakashima, Daisuke; Yamamoto, Hisashi Angewandte Chemie - International Edition, 2008 , vol. 47, # 13 p. 2411 - 2413 |
|
~36%
N-(4-Chlorophen... CAS#:19865-60-2 |
| Literature: Banerji, Avijit; Biswas, Pizush Kanti; Gupta, Maya; Saha, Rina; Banerji, Julie Journal of the Indian Chemical Society, 2007 , vol. 84, # 10 p. 1004 - 1010 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |