(2-ISOPROPYL-PHENOXY)-ACETICACID structure
|
Common Name | (2-ISOPROPYL-PHENOXY)-ACETICACID | ||
|---|---|---|---|---|
| CAS Number | 198821-77-1 | Molecular Weight | 283.23400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H13NO7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | [acetyloxy-(2-methoxy-4-nitrophenyl)methyl] acetate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H13NO7 |
|---|---|
| Molecular Weight | 283.23400 |
| Exact Mass | 283.06900 |
| PSA | 107.65000 |
| LogP | 2.25140 |
| InChIKey | GMHRDXGOIVQOSW-UHFFFAOYSA-N |
| SMILES | COc1cc([N+](=O)[O-])ccc1C(OC(C)=O)OC(C)=O |
| HS Code | 2918990090 |
|---|
|
~51%
(2-ISOPROPYL-PH... CAS#:198821-77-1 |
| Literature: Bioorganic and Medicinal Chemistry Letters, , vol. 12, # 9 p. 1323 - 1326 |
|
~51%
(2-ISOPROPYL-PH... CAS#:198821-77-1 |
| Literature: US6624184 B1, ; |
|
~52%
(2-ISOPROPYL-PH... CAS#:198821-77-1 |
| Literature: Bioorganic and Medicinal Chemistry Letters, , vol. 12, # 20 p. 2879 - 2882 |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2-methoxy-4-nitrobenzylidene diacetate |
| 1-diacetoxymethyl-2-methoxy-4-nitro-benzene |
| 1-Diacetoxymethyl-2-methoxy-4-nitro-benzol |