2-Methoxy-4-nitrobenzaldehyde structure
|
Common Name | 2-Methoxy-4-nitrobenzaldehyde | ||
|---|---|---|---|---|
| CAS Number | 136507-15-8 | Molecular Weight | 181.145 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 354.7±27.0 °C at 760 mmHg | |
| Molecular Formula | C8H7NO4 | Melting Point | 120-124ºC | |
| MSDS | Chinese USA | Flash Point | 184.2±25.7 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 2-Methoxy-4-nitrobenzaldehyde |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 354.7±27.0 °C at 760 mmHg |
| Melting Point | 120-124ºC |
| Molecular Formula | C8H7NO4 |
| Molecular Weight | 181.145 |
| Flash Point | 184.2±25.7 °C |
| Exact Mass | 181.037506 |
| PSA | 72.12000 |
| LogP | 1.94 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.590 |
| InChIKey | LEBUUZXTHMCZQZ-UHFFFAOYSA-N |
| SMILES | COc1cc([N+](=O)[O-])ccc1C=O |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H317 |
| Precautionary Statements | P280 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Faceshields;Gloves |
| Hazard Codes | Xi:Irritant; |
| Risk Phrases | R43 |
| Safety Phrases | S36/37 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2913000090 |
| Precursor 9 | |
|---|---|
| DownStream 4 | |
| HS Code | 2913000090 |
|---|---|
| Summary | HS: 2913000090 halogenated, sulphonated, nitrated or nitrosated derivatives of products of heading 2912 Educational tariff:17.0% Tax rebate rate:9.0% Regulatory conditions:none Most favored nation tariff:5.5% General tariff:30.0% |
|
Heterocycles 68 , 167, (2006)
|
|
|
Org. Process Res. Dev. 6 , 677, (2002)
|
| 2-Methoxy-4-nitrobenzaldehyde |
| Benzaldehyde, 2-methoxy-4-nitro- |
| MFCD02683052 |