2-(4-nitrophenyl)propionic acid structure
|
Common Name | 2-(4-nitrophenyl)propionic acid | ||
|---|---|---|---|---|
| CAS Number | 19910-33-9 | Molecular Weight | 195.17200 | |
| Density | 1.337g/cm3 | Boiling Point | 361.9ºC at 760mmHg | |
| Molecular Formula | C9H9NO4 | Melting Point | 88-89 °C(lit.) | |
| MSDS | USA | Flash Point | 160.5ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 2-(4-nitrophenyl)propanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.337g/cm3 |
|---|---|
| Boiling Point | 361.9ºC at 760mmHg |
| Melting Point | 88-89 °C(lit.) |
| Molecular Formula | C9H9NO4 |
| Molecular Weight | 195.17200 |
| Flash Point | 160.5ºC |
| Exact Mass | 195.05300 |
| PSA | 83.12000 |
| LogP | 2.30610 |
| Vapour Pressure | 7.16E-06mmHg at 25°C |
| Index of Refraction | 1.579 |
| InChIKey | RBSRRICSXWXMRC-UHFFFAOYSA-N |
| SMILES | CC(C(=O)O)c1ccc([N+](=O)[O-])cc1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S37/39 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2916399090 |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| EINECS 243-423-8 |
| MFCD00012106 |