dntpd structure
|
Common Name | dntpd | ||
|---|---|---|---|---|
| CAS Number | 199121-98-7 | Molecular Weight | 879.140 | |
| Density | 1.2±0.0 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C64H54N4 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | N,N'-Bis{4-[bis(3-methylphenyl)amino]phenyl}-N,N'-diphenyl-4,4'-biphenyldiamine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.0 g/cm3 |
|---|---|
| Molecular Formula | C64H54N4 |
| Molecular Weight | 879.140 |
| Exact Mass | 878.434875 |
| LogP | 19.90 |
| Index of Refraction | 1.693 |
| InChIKey | SPDPTFAJSFKAMT-UHFFFAOYSA-N |
| SMILES | Cc1cccc(N(c2ccc(N(c3ccccc3)c3ccc(-c4ccc(N(c5ccccc5)c5ccc(N(c6cccc(C)c6)c6cccc(C)c6)cc5)cc4)cc3)cc2)c2cccc(C)c2)c1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Hazard Codes | Xi |
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26 |
| RIDADR | NONH for all modes of transport |
|
J. Mater. Chem. 11th ed., 22 , 5145-5154, (2012)
|
|
|
Synt. Metals 17-18th ed., 161 , 2024-2030, (2011)
|
|
|
Adv. Funct. Mater. 8th ed., 20 , 1345-1358, (2010)
|
| 1,4-Benzenediamine, N4,N4'-[1,1'-biphenyl]-4,4'-diylbis[N1,N1-bis(3-methylphenyl)-N4-phenyl- |
| MFCD22372686 |
| N,N'-Bis{4-[bis(3-methylphenyl)amino]phenyl}-N,N'-diphenyl-4,4'-biphenyldiamine |