1,2,3,4-tetrabromo-1,2,3,4-tetrahydronaphthalene structure
|
Common Name | 1,2,3,4-tetrabromo-1,2,3,4-tetrahydronaphthalene | ||
|---|---|---|---|---|
| CAS Number | 19922-78-2 | Molecular Weight | 447.78700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H8Br4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,2,3,4-tetrabromo-1,2,3,4-tetrahydronaphthalene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H8Br4 |
|---|---|
| Molecular Weight | 447.78700 |
| Exact Mass | 443.73600 |
| LogP | 5.09920 |
| InChIKey | BKCUPGMGWWQGQD-UHFFFAOYSA-N |
| SMILES | BrC1c2ccccc2C(Br)C(Br)C1Br |
|
~23%
1,2,3,4-tetrabr... CAS#:19922-78-2 |
| Literature: Bolton, Roger; Bhangar, Muhammad Iqbal; Williams, Gareth H. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1984 , # 5 p. 893 - 896 |
|
~35%
1,2,3,4-tetrabr... CAS#:19922-78-2 |
| Literature: Bolton, Roger; Bhangar, Muhammad Iqbal; Williams, Gareth H. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1984 , # 5 p. 893 - 896 |
| Precursor 1 | |
|---|---|
| DownStream 3 | |
| Naphthalene,1,2,3,4-tetrabromo-1,2,3,4-tetrahydro |
| 1,2,3,4-tetrabromo-1,2,3,4-tetrahydro-naphthalene |
| 1,2,3,4-Tetrabrom-1,2,3,4-tetrahydro-naphthalin |