Glyurallin B structure
|
Common Name | Glyurallin B | ||
|---|---|---|---|---|
| CAS Number | 199331-53-8 | Molecular Weight | 422.47 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C25H26O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Glyurallin BGlyurallin B is a flavonoid, that can be isolated from licorice (Glycyrrhiza inflata and Glycyrrhiza uralensis). Glyurallin B shows ABTS+ radical scavenging activity and the inhibitory activity on lipid peroxidation, with EC50 values of 11.9 ± 0.58 μM and 15.3 ± 1.26 μM, respectivley[1]. |
| Name | Glyurallin B |
|---|
| Description | Glyurallin B is a flavonoid, that can be isolated from licorice (Glycyrrhiza inflata and Glycyrrhiza uralensis). Glyurallin B shows ABTS+ radical scavenging activity and the inhibitory activity on lipid peroxidation, with EC50 values of 11.9 ± 0.58 μM and 15.3 ± 1.26 μM, respectivley[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C25H26O6 |
|---|---|
| Molecular Weight | 422.47 |
| InChIKey | DPLWUTYEBRKBLI-UHFFFAOYSA-N |
| SMILES | CC(C)=CCc1cc(-c2coc3c(CC=C(C)C)c(O)cc(O)c3c2=O)cc(O)c1O |