1-chloro-4-(2,2,2-trifluoro-1-phenyl-ethyl)benzene structure
|
Common Name | 1-chloro-4-(2,2,2-trifluoro-1-phenyl-ethyl)benzene | ||
|---|---|---|---|---|
| CAS Number | 1996-64-1 | Molecular Weight | 270.67700 | |
| Density | 1.262g/cm3 | Boiling Point | 280.2ºC at 760 mmHg | |
| Molecular Formula | C14H10ClF3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 120ºC | |
| Name | 1-chloro-4-(2,2,2-trifluoro-1-phenylethyl)benzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.262g/cm3 |
|---|---|
| Boiling Point | 280.2ºC at 760 mmHg |
| Molecular Formula | C14H10ClF3 |
| Molecular Weight | 270.67700 |
| Flash Point | 120ºC |
| Exact Mass | 270.04200 |
| LogP | 5.03420 |
| Vapour Pressure | 0.00652mmHg at 25°C |
| Index of Refraction | 1.523 |
| InChIKey | WEDRCQRYHWBWEE-UHFFFAOYSA-N |
| SMILES | FC(F)(F)C(c1ccccc1)c1ccc(Cl)cc1 |
|
~%
1-chloro-4-(2,2... CAS#:1996-64-1 |
| Literature: Bergmann,E.D. et al. Israel Journal of Chemistry, 1963 , vol. 1, p. 129 - 135 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2.2.2-Trifluor-1-phenyl-1-(4-chlor-phenyl)-aethan |