4-(4-Methoxyphenoxy)-3-nitrobenzotrifluoride structure
|
Common Name | 4-(4-Methoxyphenoxy)-3-nitrobenzotrifluoride | ||
|---|---|---|---|---|
| CAS Number | 1996-69-6 | Molecular Weight | 313.22900 | |
| Density | 1.365g/cm3 | Boiling Point | 349ºC at 760mmHg | |
| Molecular Formula | C14H10F3NO4 | Melting Point | 45 °C | |
| MSDS | N/A | Flash Point | 164.9ºC | |
| Name | 4-(4-Methoxyphenoxy)-3-nitrobenzotrifluoride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.365g/cm3 |
|---|---|
| Boiling Point | 349ºC at 760mmHg |
| Melting Point | 45 °C |
| Molecular Formula | C14H10F3NO4 |
| Molecular Weight | 313.22900 |
| Flash Point | 164.9ºC |
| Exact Mass | 313.05600 |
| PSA | 64.28000 |
| LogP | 4.93770 |
| InChIKey | WJNPONNEXMSLPF-UHFFFAOYSA-N |
| SMILES | COc1ccc(Oc2ccc(C(F)(F)F)cc2[N+](=O)[O-])cc1 |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | R20/21/22 |
| Safety Phrases | S23-S26-S36/37/39 |
| HS Code | 2909309090 |
|
~56%
4-(4-Methoxyphe... CAS#:1996-69-6 |
| Literature: Sawyer, J. Scott; Schmittling, Elisabeth A.; Palkowitz, Jayne A.; Smith III, William J. Journal of Organic Chemistry, 1998 , vol. 63, # 18 p. 6338 - 6343 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2909309090 |
|---|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 1-(4-methoxyphenoxy)-2-nitro-4-(trifluoromethyl)benzene |
| MFCD00052260 |