Carbamic acid,N-(3-hydroxyphenyl)-, 1,1-dimethylethyl ester structure
|
Common Name | Carbamic acid,N-(3-hydroxyphenyl)-, 1,1-dimethylethyl ester | ||
|---|---|---|---|---|
| CAS Number | 19962-06-2 | Molecular Weight | 209.24200 | |
| Density | 1.182g/cm3 | Boiling Point | 286.8ºC at 760mmHg | |
| Molecular Formula | C11H15NO3 | Melting Point | 134-138ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | 127.3ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | tert-butyl N-(3-hydroxyphenyl)carbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.182g/cm3 |
|---|---|
| Boiling Point | 286.8ºC at 760mmHg |
| Melting Point | 134-138ºC(lit.) |
| Molecular Formula | C11H15NO3 |
| Molecular Weight | 209.24200 |
| Flash Point | 127.3ºC |
| Exact Mass | 209.10500 |
| PSA | 58.56000 |
| LogP | 2.81220 |
| Vapour Pressure | 0.00149mmHg at 25°C |
| Index of Refraction | 1.569 |
| InChIKey | HJQNVUQTARSZDK-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)Nc1cccc(O)c1 |
|
~90%
Carbamic acid,N... CAS#:19962-06-2 |
| Literature: European Journal of Organic Chemistry, , # 22 p. 3740 - 3744 |
|
~97%
Carbamic acid,N... CAS#:19962-06-2 |
| Literature: Bioorganic and Medicinal Chemistry, , vol. 21, # 22 p. 7107 - 7117 |
|
~%
Carbamic acid,N... CAS#:19962-06-2 |
| Literature: European Journal of Organic Chemistry, , # 19 p. 3704 - 3710 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| t-butyloxycarbonylamino-3-hydroxybenzene |
| 3-t-butoxycarbonylaminophenol |
| 3-Boc-aminophenol |
| N-Boc-3-aminophenol |
| TERT-BUTYL 3-HYDROXYPHENYLCARBAMATE |