methyl 3-fluoro-2-(naphthalene-1-carbonyl)benzoate structure
|
Common Name | methyl 3-fluoro-2-(naphthalene-1-carbonyl)benzoate | ||
|---|---|---|---|---|
| CAS Number | 1997-08-6 | Molecular Weight | 308.30300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H13FO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | methyl 3-fluoro-2-(naphthalene-1-carbonyl)benzoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C19H13FO3 |
|---|---|
| Molecular Weight | 308.30300 |
| Exact Mass | 308.08500 |
| PSA | 43.37000 |
| LogP | 3.99650 |
| Vapour Pressure | 3.91E-09mmHg at 25°C |
| InChIKey | ZYMDKJPWADVWPM-UHFFFAOYSA-N |
| SMILES | COC(=O)c1cccc(F)c1C(=O)c1cccc2ccccc12 |
|
~%
methyl 3-fluoro... CAS#:1997-08-6 |
| Literature: Newman,M.S.; Wiseman,E.H. Journal of Organic Chemistry, 1961 , vol. 26, p. 3208 - 3211 |
|
~%
methyl 3-fluoro... CAS#:1997-08-6 |
| Literature: Newman,M.S.; Wiseman,E.H. Journal of Organic Chemistry, 1961 , vol. 26, p. 3208 - 3211 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HMS3080H10 |
| methyl 3-fluoro-2-(naphthalen-1-ylcarbonyl)benzoate |
| 3-Fluor-2-(naphthoyl-(1))-benzoesaeure-methylester |
| 3-Fluor-2-(naphtho-1-yl)-benzoesaeure-methylester |