H-DL-Ala-DL-Val-OH structure
|
Common Name | H-DL-Ala-DL-Val-OH | ||
|---|---|---|---|---|
| CAS Number | 1999-46-8 | Molecular Weight | 188.22400 | |
| Density | 1.134g/cm3 | Boiling Point | 401.8ºC at 760mmHg | |
| Molecular Formula | C8H16N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 196.8ºC | |
| Name | 2-(2-aminopropanoylamino)-3-methylbutanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.134g/cm3 |
|---|---|
| Boiling Point | 401.8ºC at 760mmHg |
| Molecular Formula | C8H16N2O3 |
| Molecular Weight | 188.22400 |
| Flash Point | 196.8ºC |
| Exact Mass | 188.11600 |
| PSA | 92.42000 |
| LogP | 0.65020 |
| Vapour Pressure | 1.4E-07mmHg at 25°C |
| Index of Refraction | 1.486 |
| InChIKey | LIWMQSWFLXEGMA-UHFFFAOYSA-N |
| SMILES | CC(N)C(=O)NC(C(=O)O)C(C)C |
| Storage condition | −20°C |
| WGK Germany | 3 |
|---|---|
| HS Code | 2924199090 |
| HS Code | 2924199090 |
|---|---|
| Summary | 2924199090. other acyclic amides (including acyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| DL-Alanyl-DL-valine |
| H-DL-ALA-DL-VAL-OH |
| DL-ALANYL-DL-VALINE |