alpha,alpha,alpha',alpha'-tetramethyl-m-xylene-alpha,alpha'-diol structure
|
Common Name | alpha,alpha,alpha',alpha'-tetramethyl-m-xylene-alpha,alpha'-diol | ||
|---|---|---|---|---|
| CAS Number | 1999-85-5 | Molecular Weight | 194.27000 | |
| Density | 1.051 g/cm3 | Boiling Point | 295.6ºC at 760 mmHg | |
| Molecular Formula | C12H18O2 | Melting Point | 137-140ºC(lit.) | |
| MSDS | N/A | Flash Point | 134.6ºC | |
| Name | 2-[3-(2-hydroxypropan-2-yl)phenyl]propan-2-ol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.051 g/cm3 |
|---|---|
| Boiling Point | 295.6ºC at 760 mmHg |
| Melting Point | 137-140ºC(lit.) |
| Molecular Formula | C12H18O2 |
| Molecular Weight | 194.27000 |
| Flash Point | 134.6ºC |
| Exact Mass | 194.13100 |
| PSA | 40.46000 |
| LogP | 2.14140 |
| Vapour Pressure | 0.000681mmHg at 25°C |
| Index of Refraction | 1.527 |
| InChIKey | UGPWRRVOLLMHSC-UHFFFAOYSA-N |
| SMILES | CC(C)(O)c1cccc(C(C)(C)O)c1 |
| Hazard Codes | Xn: Harmful; |
|---|---|
| Risk Phrases | R22 |
| Safety Phrases | 26 |
| HS Code | 2906299090 |
|
~85%
alpha,alpha,alp... CAS#:1999-85-5 |
| Literature: SUMITOMO CHEMICAL COMPANY, LIMITED Patent: US2007/197838 A1, 2007 ; Location in patent: Page/Page column 3-4 ; |
|
~%
alpha,alpha,alp... CAS#:1999-85-5 |
| Literature: Journal of Organic Chemistry USSR (English Translation), , p. 336 - 338 Zhurnal Organicheskoi Khimii, , vol. 22, # 2 p. 381 - 383 |
|
~%
alpha,alpha,alp... CAS#:1999-85-5
Detail
|
| Literature: J. Appl. Chem. USSR (Engl. Transl.), , vol. 55, # 3 p. 658 - 662,597 - 601 |
| HS Code | 2906299090 |
|---|---|
| Summary | 2906299090 other aromatic alcohols。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| α,α,α',α'-Tetramethyl-1,3-benzenedimethanol |
| EINECS 217-886-1 |
| 2,2'-(1,3-phenylene)dipropan-2-ol |
| MFCD00059139 |
| 1,3-bis(1',1'-dimethylhydroxymethyl)benzene |
| 1,3-di-(2-hydroxy-2-propyl)benzene |
| 1,3-Bis(α-hydroxyisopropyl)benzene |
| 2,2'-(m-Phenylene)di-2-propanol |
| diisopropylbenzene dicarbinol |
| 1,3-bis(1-hydroxy-1-methylethyl)benzene |
| ALPHA,ALPHA'-DIHYDROXY-1,3-DIISOPROPYLBENZENE |
| 1,3-bis(hydroxyisopropyl)benzene |