4,4',4''-Trifluorotrityl Bromide structure
|
Common Name | 4,4',4''-Trifluorotrityl Bromide | ||
|---|---|---|---|---|
| CAS Number | 200004-38-2 | Molecular Weight | 377.19800 | |
| Density | 1.458g/cm3 | Boiling Point | 385.6ºC at 760 mmHg | |
| Molecular Formula | C19H12BrF3 | Melting Point | 109ºC | |
| MSDS | N/A | Flash Point | 236.3ºC | |
| Name | 1-[bromo-bis(4-fluorophenyl)methyl]-4-fluorobenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.458g/cm3 |
|---|---|
| Boiling Point | 385.6ºC at 760 mmHg |
| Melting Point | 109ºC |
| Molecular Formula | C19H12BrF3 |
| Molecular Weight | 377.19800 |
| Flash Point | 236.3ºC |
| Exact Mass | 376.00700 |
| LogP | 5.79070 |
| Vapour Pressure | 8.37E-06mmHg at 25°C |
| Index of Refraction | 1.589 |
| InChIKey | DYMCGODRYMABQY-UHFFFAOYSA-N |
| SMILES | Fc1ccc(C(Br)(c2ccc(F)cc2)c2ccc(F)cc2)cc1 |
| Hazard Codes | Xi |
|---|---|
| Risk Phrases | R34 |
| Safety Phrases | S36-S37-S39 |
| RIDADR | UN 3261 |
| HS Code | 2903999090 |
| HS Code | 2903999090 |
|---|---|
| Summary | 2903999090 halogenated derivatives of aromatic hydrocarbons VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| DYMCGODRYMABQY-UHFFFAOYSA |
| 4,4',4''-Trifluorotrityl BroMide |
| 4,4',4''-Trifluorotrityl Bromide |