L-2-Thiolhistidine structure
|
Common Name | L-2-Thiolhistidine | ||
|---|---|---|---|---|
| CAS Number | 2002-22-4 | Molecular Weight | 187.220 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 376.3±52.0 °C at 760 mmHg | |
| Molecular Formula | C6H9N3O2S | Melting Point | 320-325ºC | |
| MSDS | USA | Flash Point | 181.4±30.7 °C | |
| Name | 2-Mercapto-L-histidine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 376.3±52.0 °C at 760 mmHg |
| Melting Point | 320-325ºC |
| Molecular Formula | C6H9N3O2S |
| Molecular Weight | 187.220 |
| Flash Point | 181.4±30.7 °C |
| Exact Mass | 187.041550 |
| PSA | 130.80000 |
| LogP | 0.16 |
| Vapour Pressure | 0.0±1.8 mmHg at 25°C |
| Index of Refraction | 1.695 |
| InChIKey | FVNKWWBXNSNIAR-BYPYZUCNSA-N |
| SMILES | NC(Cc1c[nH]c(=S)[nH]1)C(=O)O |
| Storage condition | -15°C |
| HS Code | 2933290090 |
|---|
| HS Code | 2933290090 |
|---|---|
| Summary | 2933290090. other compounds containing an unfused imidazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3-(2-Thioxo-2,3-dihydro-1H-imidazol-4-yl)alanine |
| (S)-2-Amino-3-(2-thioxo-2,3-dihydro-1H-imidazol-4-yl)propanoic acid |
| 2-MERCAPTO-L-HISTIDINE |
| 2-Sulfanyl-L-histidine |
| 2-Thiol-L-histidine |
| UNII:MH6EDB26P8 |
| (2S)-2-amino-3-(2-sulfanylidene-1,3-dihydroimidazol-4-yl)propanoic acid |