Phenothiazin-3-ol, 8-chloro structure
|
Common Name | Phenothiazin-3-ol, 8-chloro | ||
|---|---|---|---|---|
| CAS Number | 2002-32-6 | Molecular Weight | 249.716 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 466.9±45.0 °C at 760 mmHg | |
| Molecular Formula | C12H8ClNOS | Melting Point | 205-210ºC (dec.) | |
| MSDS | N/A | Flash Point | 236.2±28.7 °C | |
| Name | 8-chloro-10H-phenothiazin-3-ol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 466.9±45.0 °C at 760 mmHg |
| Melting Point | 205-210ºC (dec.) |
| Molecular Formula | C12H8ClNOS |
| Molecular Weight | 249.716 |
| Flash Point | 236.2±28.7 °C |
| Exact Mass | 249.001511 |
| PSA | 57.56000 |
| LogP | 4.44 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Index of Refraction | 1.714 |
| InChIKey | CIAFBHJSFCQEBJ-UHFFFAOYSA-N |
| SMILES | Oc1ccc2c(c1)Sc1ccc(Cl)cc1N2 |
| HS Code | 2934300000 |
|---|
|
~%
Phenothiazin-3-... CAS#:2002-32-6 |
| Literature: Journal of Organic Chemistry, , vol. 24, p. 986 |
|
~%
Phenothiazin-3-... CAS#:2002-32-6 |
| Literature: Journal of Heterocyclic Chemistry, , vol. 4, p. 611 - 618 |
|
~%
Phenothiazin-3-... CAS#:2002-32-6 |
| Literature: Journal of Heterocyclic Chemistry, , vol. 4, p. 611 - 618 |
|
~%
Phenothiazin-3-... CAS#:2002-32-6 |
| Literature: Journal of Organic Chemistry, , vol. 24, p. 986 |
| Precursor 4 | |
|---|---|
| DownStream 5 | |
| HS Code | 2934300000 |
|---|---|
| Summary | 2934300000. other compounds containing in the structure a phenothiazine ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 10H-Phenothiazin-3-ol,8-chloro |
| 2-Chlor-7-hydroxy-phenthiazin |
| 2-Chlor-7-hydroxyphenothiazin |
| 8-Chloro-phenothiazin-3-ol |
| 8-chlor-10H-phenothiazin-3-ol |
| 8-Chloro-10H-phenothiazin-3-ol |
| 2-Chloro-7-hydroxyphenothiazine |
| 8-Chlor-phenothiazin-3-ol |
| Phenothiazin-3-ol,8-chloro |