Ethyl 2-(5-bromobenzofuran-3-yl)acetate structure
|
Common Name | Ethyl 2-(5-bromobenzofuran-3-yl)acetate | ||
|---|---|---|---|---|
| CAS Number | 200204-85-9 | Molecular Weight | 283.118 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 341.7±27.0 °C at 760 mmHg | |
| Molecular Formula | C12H11BrO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 160.4±23.7 °C | |
| Name | Ethyl 2-(5-bromobenzofuran-3-yl)acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 341.7±27.0 °C at 760 mmHg |
| Molecular Formula | C12H11BrO3 |
| Molecular Weight | 283.118 |
| Flash Point | 160.4±23.7 °C |
| Exact Mass | 281.989136 |
| PSA | 39.44000 |
| LogP | 3.72 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.589 |
| InChIKey | NWCIURORZMAWNA-UHFFFAOYSA-N |
| SMILES | CCOC(=O)Cc1coc2ccc(Br)cc12 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2932999099 |
|
~%
Ethyl 2-(5-brom... CAS#:200204-85-9 |
| Literature: Journal of the American Chemical Society, , vol. 129, # 26 p. 8328 - 8332 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Ethyl (5-bromo-1-benzofuran-3-yl)acetate |
| ethyl 2-(5-bromo-1-benzofuran-3-yl)acetate |
| 3-Benzofuranacetic acid, 5-bromo-, ethyl ester |