Urea,N,N-bis(2-chloroethyl)-N'-1-naphthalenyl- structure
|
Common Name | Urea,N,N-bis(2-chloroethyl)-N'-1-naphthalenyl- | ||
|---|---|---|---|---|
| CAS Number | 2003-44-3 | Molecular Weight | 311.20600 | |
| Density | 1.317g/cm3 | Boiling Point | 526.1ºC at 760mmHg | |
| Molecular Formula | C15H16Cl2N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 272ºC | |
| Name | 1,1-bis(2-chloroethyl)-3-naphthalen-1-ylurea |
|---|---|
| Synonym | More Synonyms |
| Density | 1.317g/cm3 |
|---|---|
| Boiling Point | 526.1ºC at 760mmHg |
| Molecular Formula | C15H16Cl2N2O |
| Molecular Weight | 311.20600 |
| Flash Point | 272ºC |
| Exact Mass | 310.06400 |
| PSA | 32.34000 |
| LogP | 4.22430 |
| Vapour Pressure | 3.7E-11mmHg at 25°C |
| Index of Refraction | 1.645 |
| InChIKey | ACCSWAHUGLGDLY-UHFFFAOYSA-N |
| SMILES | O=C(Nc1cccc2ccccc12)N(CCCl)CCCl |
| HS Code | 2924299090 |
|---|
|
~%
Urea,N,N-bis(2-... CAS#:2003-44-3 |
| Literature: Pettit,G.R. et al. Canadian Journal of Chemistry, 1965 , vol. 43, p. 1798 - 1802 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N-<Naphthyl-(1)>-N'-bis-<2-chlor-aethyl>-harnstoff |
| 1,1-bis-(2-chloro-ethyl)-3-naphthalen-1-yl-urea |