Mal-Ala-Ala-PAB-PNP structure
|
Common Name | Mal-Ala-Ala-PAB-PNP | ||
|---|---|---|---|---|
| CAS Number | 2003260-14-6 | Molecular Weight | 623.61 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C30H33N5O10 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Mal-Ala-Ala-PAB-PNPMal-Ala-Ala-PAB-PNP is a cleavable ADC linker used in the synthesis of antibody-drug conjugates (ADCs)[1]. |
| Name | Mal-Ala-Ala-PAB-PNP |
|---|
| Description | Mal-Ala-Ala-PAB-PNP is a cleavable ADC linker used in the synthesis of antibody-drug conjugates (ADCs)[1]. |
|---|---|
| Related Catalog | |
| Target |
Cleavable |
| In Vitro | ADCs are comprised of an antibody to which is attached an ADC cytotoxin through an ADC linker[1]. |
| References |
| Molecular Formula | C30H33N5O10 |
|---|---|
| Molecular Weight | 623.61 |
| InChIKey | GEMSBDIHVHIIDT-PMACEKPBSA-N |
| SMILES | CC(NC(=O)CCCCCN1C(=O)C=CC1=O)C(=O)NC(C)C(=O)Nc1ccc(COC(=O)Oc2ccc([N+](=O)[O-])cc2)cc1 |