Picralinal structure
|
Common Name | Picralinal | ||
|---|---|---|---|---|
| CAS Number | 20045-06-1 | Molecular Weight | 366.410 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 538.6±50.0 °C at 760 mmHg | |
| Molecular Formula | C21H22N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 279.5±30.1 °C | |
| Name | Methyl (2β,5β,15α,16ξ,19Z)-17-oxo-1,2-dihydro-2,5-epoxyakuammilan -16-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 538.6±50.0 °C at 760 mmHg |
| Molecular Formula | C21H22N2O4 |
| Molecular Weight | 366.410 |
| Flash Point | 279.5±30.1 °C |
| Exact Mass | 366.157959 |
| PSA | 67.87000 |
| LogP | 3.33 |
| Vapour Pressure | 0.0±1.4 mmHg at 25°C |
| Index of Refraction | 1.678 |
| InChIKey | RHBAENOZUZWALZ-UHFFFAOYSA-N |
| SMILES | CC=C1CN2C3CC45c6ccccc6NC4(O3)C2CC1C5(C=O)C(=O)OC |
| Hazard Codes | Xi |
|---|
|
~%
Picralinal CAS#:20045-06-1 |
| Literature: Britten,A.Z.; Smith,G.F. Journal of the Chemical Society, 1963 , p. 3850 - 3854 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| Methyl (19E)-16-formyl-1,2-dihydro-2,5-epoxyakuammilan-17-oate |
| 2H,12H-6,12a-Epoxy-2,7a-methanoindolo[2,3-a]quinolizine-14-carboxylic acid, 3-ethylidene-14-formyl-1,3,4,6,7,12b-hexahydro-, methyl ester, (3E)- |
| Picralinal |