Fmoc-N-Me-Glu(OtBu)-OH structure
|
Common Name | Fmoc-N-Me-Glu(OtBu)-OH | ||
|---|---|---|---|---|
| CAS Number | 200616-40-6 | Molecular Weight | 439.501 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 612.3±55.0 °C at 760 mmHg | |
| Molecular Formula | C25H29NO6 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 324.1±31.5 °C | |
| Symbol |
GHS09 |
Signal Word | Warning | |
Use of Fmoc-N-Me-Glu(OtBu)-OHFmoc-N-Me-Glu(OtBu)-OH is a glutamic acid derivative[1]. |
| Name | Fmoc-N-methyl-L-glutamic acid 5-tert-butyl ester |
|---|---|
| Synonym | More Synonyms |
| Description | Fmoc-N-Me-Glu(OtBu)-OH is a glutamic acid derivative[1]. |
|---|---|
| Related Catalog | |
| In Vitro | Amino acids and amino acid derivatives have been commercially used as ergogenic supplements. They influence the secretion of anabolic hormones, supply of fuel during exercise, mental performance during stress related tasks and prevent exercise induced muscle damage. They are recognized to be beneficial as ergogenic dietary substances[1]. |
| References |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 612.3±55.0 °C at 760 mmHg |
| Molecular Formula | C25H29NO6 |
| Molecular Weight | 439.501 |
| Flash Point | 324.1±31.5 °C |
| Exact Mass | 439.199493 |
| PSA | 93.14000 |
| LogP | 5.75 |
| Vapour Pressure | 0.0±1.9 mmHg at 25°C |
| Index of Refraction | 1.570 |
| InChIKey | FVUASVBQADLDRO-NRFANRHFSA-N |
| SMILES | CN(C(=O)OCC1c2ccccc2-c2ccccc21)C(CCC(=O)OC(C)(C)C)C(=O)O |
| Storage condition | -15°C |
| (2S)-2-{[(9H-Fluoren-9-ylmethoxy)carbonyl](methyl)amino}-5-[(2-methyl-2-propanyl)oxy]-5-oxopentanoic acid |
| MFCD00237028 |
| (2S)-5-tert-Butoxy-2-{[(9H-fluoren-9-ylmethoxy)carbonyl](methyl)amino}-5-oxopentanoic acid (non-preferred name) |
| L-Glutamic acid, N-[(9H-fluoren-9-ylmethoxy)carbonyl]-N-methyl-, 5-(1,1-dimethylethyl) ester |
| N-Methyl glutamic acid |
| N-(9-Fluorenylmethyloxycarbonyl)-N-methyl-L-glutamic acid 5-tert-butyl ester |
| FMOC-L-MEGLU(TBU)-OH |
| Fmoc-N-Me-Glu(OtBu)-OH |
| FMOC-MEGLU(OTBU)-OH |
| FMOC-N-ME-GLUTAMIC ACID(OTBU)-OH |
| REF DUPL: Fmoc-N-Me-Glu(OtBu)-OH |