Bodipy TR alkyne structure
|
Common Name | Bodipy TR alkyne | ||
|---|---|---|---|---|
| CAS Number | 2006345-35-1 | Molecular Weight | 461.291 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C24H18BF2N3O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Bodipy TR alkyneBDP TR is a borondipyrromethene fluorophore for ROX (Texas Red) channel. This is a universal fluorophore that can be used for microscopy, fluorescence polarization assay, and other applications. This derivative is a terminal alkyne for copper-catalyzed Click chemistry. |
| Name | Difluoro{N-(2-propyn-1-yl)-2-[4-(5-{[5-(2-thienyl)-2H-pyrrol-2-ylidene-κN]methyl}-1H-pyrrol-2-yl-κN)phenoxy]acetamidato}boron |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C24H18BF2N3O2S |
|---|---|
| Molecular Weight | 461.291 |
| Exact Mass | 461.118073 |
| InChIKey | NRAIVGWGVIETRD-UHFFFAOYSA-N |
| SMILES | C#CCNC(=O)COc1ccc(-c2ccc3n2[B-](F)(F)[N+]2=C(c4cccs4)C=CC2=C3)cc1 |
| Boron, difluoro[N-2-propyn-1-yl-2-[4-[5-[[5-(2-thienyl)-2H-pyrrol-2-ylidene-κN]methyl]-1H-pyrrol-2-yl-κN]phenoxy]acetamidato]- |
| Difluoro{N-(2-propyn-1-yl)-2-[4-(5-{[5-(2-thienyl)-2H-pyrrol-2-ylidene-κN]methyl}-1H-pyrrol-2-yl-κN)phenoxy]acetamidato}boron |