BDP 650/665 alkyne structure
|
Common Name | BDP 650/665 alkyne | ||
|---|---|---|---|---|
| CAS Number | 2006345-40-8 | Molecular Weight | 470.29 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C26H21BF2N4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of BDP 650/665 alkyneBDP 650/665 is a bright borondipyrromethene dye designed to fit Cy5 channel of various instruments. The terminal ethynyl group of BDP 650/665 alkyne can be easily conjugated with various azides using a copper-catalyzed Click chemistry reaction. |
| Name | BDP 650/665 alkyne |
|---|
| Description | BDP 650/665 is a bright borondipyrromethene dye designed to fit Cy5 channel of various instruments. The terminal ethynyl group of BDP 650/665 alkyne can be easily conjugated with various azides using a copper-catalyzed Click chemistry reaction. |
|---|
| Molecular Formula | C26H21BF2N4O2 |
|---|---|
| Molecular Weight | 470.29 |
| InChIKey | SVLHJAJWKKRWIX-HAAWTFQLSA-N |
| SMILES | C#CCNC(=O)COc1ccc(C=Cc2ccc3n2B(F)[N+]2=C(c4ccc[nH]4)C=CC2=C3)cc1.[F-] |