BDP TMR alkyne structure
|
Common Name | BDP TMR alkyne | ||
|---|---|---|---|---|
| CAS Number | 2006345-32-8 | Molecular Weight | 435.28 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C24H24BF2N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of BDP TMR alkyneBDP TMR alkyne is an alkyne-containing click chemistry reagent that can click chemistry with azides. BDP TMR alkyne has the fluorophore BDP and can be used for oligonucleotide labeling and amino acid sequencing. |
| Name | BDP TMR alkyne |
|---|
| Description | BDP TMR alkyne is an alkyne-containing click chemistry reagent that can click chemistry with azides. BDP TMR alkyne has the fluorophore BDP and can be used for oligonucleotide labeling and amino acid sequencing. |
|---|---|
| Related Catalog |
| Molecular Formula | C24H24BF2N3O2 |
|---|---|
| Molecular Weight | 435.28 |
| InChIKey | HBRMSAJWEIMAKR-UHFFFAOYSA-N |
| SMILES | C#CCNC(=O)CCC1=C(C)C2=Cc3ccc(-c4ccc(OC)cc4)n3[B-](F)(F)[N+]2=C1C |
| Storage condition | -20°C |