anthra[10,4-cd:9,8-c'd']bis[1,2]oxazole structure
|
Common Name | anthra[10,4-cd:9,8-c'd']bis[1,2]oxazole | ||
|---|---|---|---|---|
| CAS Number | 201-88-7 | Molecular Weight | 234.21000 | |
| Density | 1.581g/cm3 | Boiling Point | 232.4ºC at 760 mmHg | |
| Molecular Formula | C14H6N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 79.8ºC | |
| Name | anthra[9,1-cd,10,5-c'd']diisoxazole |
|---|
| Density | 1.581g/cm3 |
|---|---|
| Boiling Point | 232.4ºC at 760 mmHg |
| Molecular Formula | C14H6N2O2 |
| Molecular Weight | 234.21000 |
| Flash Point | 79.8ºC |
| Exact Mass | 234.04300 |
| PSA | 52.06000 |
| LogP | 3.71320 |
| Vapour Pressure | 0.09mmHg at 25°C |
| Index of Refraction | 1.941 |
| InChIKey | VRQGMACYSHACCO-UHFFFAOYSA-N |
| SMILES | c1cc2onc3c4cccc5onc(c(c1)c23)c54 |
|
~%
anthra[10,4-cd:... CAS#:201-88-7 |
| Literature: Freund; Achenbach Chemische Berichte, 1910 , vol. 43, p. 3255 |
|
~%
anthra[10,4-cd:... CAS#:201-88-7 |
| Literature: Rydon et al. Journal of the Chemical Society, 1957 , p. 1900,1904 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |