Naphtho(1,8-cd:4,5-c',d')bis(1,2,6)thiadiazine structure
|
Common Name | Naphtho(1,8-cd:4,5-c',d')bis(1,2,6)thiadiazine | ||
|---|---|---|---|---|
| CAS Number | 65989-13-1 | Molecular Weight | 244.29600 | |
| Density | 1.91g/cm3 | Boiling Point | 296.6ºC at 760 mmHg | |
| Molecular Formula | C10H4N4S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 133.2ºC | |
| Name | Naphtho(1,8-cd:4,5-c',d')bis(1,2,6)thiadiazine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.91g/cm3 |
|---|---|
| Boiling Point | 296.6ºC at 760 mmHg |
| Molecular Formula | C10H4N4S2 |
| Molecular Weight | 244.29600 |
| Flash Point | 133.2ºC |
| Exact Mass | 243.98800 |
| PSA | 100.04000 |
| Index of Refraction | 2.061 |
| InChIKey | NLSMICRSODORKV-UHFFFAOYSA-N |
| SMILES | c1cc2c3c(ccc4c3c1=NSN=4)=NSN=2 |
|
~25%
Naphtho(1,8-cd:... CAS#:65989-13-1 |
| Literature: Bryce, Martin R. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1984 , # 11 p. 2591 - 2593 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| naphtho(1,8-cd:5,4-c'd')bis[1,2,6]thia(SIV)diazine |
| Naphtho-<1,8-cd:4,5-c'd'>-bis-<1,2,6>-thiodiazin |
| Naphtho[1,8-cd:4,5-c',d']bis[1,2,6]thiadiazine |
| Naphtho<1,8-c,d:4,5-c',d'>bis<1,2,6>thiadiazin |