4-chloro-(2-hydroxyhexafluoroisopropyl)benzene structure
|
Common Name | 4-chloro-(2-hydroxyhexafluoroisopropyl)benzene | ||
|---|---|---|---|---|
| CAS Number | 2010-63-1 | Molecular Weight | 278.57900 | |
| Density | 1.531g/cm3 | Boiling Point | 253.2ºC at 760mmHg | |
| Molecular Formula | C9H5ClF6O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 106.9ºC | |
| Name | 4-chloro-(2-hydroxyhexafluoroisopropyl)benzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.531g/cm3 |
|---|---|
| Boiling Point | 253.2ºC at 760mmHg |
| Molecular Formula | C9H5ClF6O |
| Molecular Weight | 278.57900 |
| Flash Point | 106.9ºC |
| Exact Mass | 277.99300 |
| PSA | 20.23000 |
| LogP | 3.65220 |
| Vapour Pressure | 0.00963mmHg at 25°C |
| Index of Refraction | 1.433 |
| InChIKey | BDVVJTPJVCAQGG-UHFFFAOYSA-N |
| SMILES | OC(c1ccc(Cl)cc1)(C(F)(F)F)C(F)(F)F |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | R36/38 |
| Safety Phrases | S26-S36 |
| HS Code | 2906299090 |
|
~%
4-chloro-(2-hyd... CAS#:2010-63-1 |
| Literature: Livshits,B.R. et al. Bulletin of the Academy of Sciences of the USSR, Division of Chemical Science (English Translation), 1967 , p. 591 - 595 Izvestiya Akademii Nauk SSSR, Seriya Khimicheskaya, 1967 , # 3 p. 614 - 618 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2906299090 |
|---|---|
| Summary | 2906299090 other aromatic alcohols。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| 4-Chlor-1-<-2-hydroxy-hexafluor-2-propyl>-benzol |