(1,5E,11E)-Tridecatriene-7,9-diyne-3,4-diacetate structure
|
Common Name | (1,5E,11E)-Tridecatriene-7,9-diyne-3,4-diacetate | ||
|---|---|---|---|---|
| CAS Number | 201012-14-8 | Molecular Weight | 300.31 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H16O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of (1,5E,11E)-Tridecatriene-7,9-diyne-3,4-diacetate(1,5E,11E)-Tridecatriene-7,9-diyne-3,4-diacetate, isolated from the ethanol extract of Atractylodes lancea rhizome, displays significant lipase inhibition with an IC50 value of 23.9 µg/mL. Antiobesity Effect[1]. |
| Name | (1,5E,11E)-Tridecatriene-7,9-diyne-3,4-diacetate |
|---|
| Description | (1,5E,11E)-Tridecatriene-7,9-diyne-3,4-diacetate, isolated from the ethanol extract of Atractylodes lancea rhizome, displays significant lipase inhibition with an IC50 value of 23.9 µg/mL. Antiobesity Effect[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C17H16O5 |
|---|---|
| Molecular Weight | 300.31 |
| InChIKey | WCXFKFDHRIMXRF-SNAWJCMRSA-N |
| SMILES | CC=CC#CC#CC(OC(C)=O)C(OC(C)=O)c1ccco1 |