Ravenine
Ravenine structure
|
Common Name | Ravenine | ||
|---|---|---|---|---|
| CAS Number | 20105-22-0 | Molecular Weight | 228.286 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 378.3±41.0 °C at 760 mmHg | |
| Molecular Formula | C15H17NO2 | Melting Point | 120-121℃ | |
| MSDS | N/A | Flash Point | 170.2±21.2 °C | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-methyl-4-((3-methylbut-2-en-1-yl)oxy)quinolin-2(1H)-one |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 378.3±41.0 °C at 760 mmHg |
| Melting Point | 120-121℃ |
| Molecular Formula | C15H17NO2 |
| Molecular Weight | 228.286 |
| Flash Point | 170.2±21.2 °C |
| Exact Mass | 228.115036 |
| PSA | 31.23000 |
| LogP | 3.81 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.563 |
| InChIKey | MADRTKVOWFLSFO-UHFFFAOYSA-N |
| SMILES | CC(C)=CCOc1cc(=O)n(C)c2ccccc12 |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| Hazard Codes | Xi |
|---|
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 1 | |
![2,2,3,9-tetramethyl-3H-furo[2,3-b]quinolin-4-one structure](https://image.chemsrc.com/caspic/379/26126-76-1.png)
CAS#:26126-76-1This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 4-[(3-Methyl-2-buten-1-yl)oxy]-2(1H)-naphthalenone |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What are the downstream products of 1-methyl-4-((3-methylbut-2-en-1-yl)oxy)quinolin-2(1H)-one? |
| A: Related downstream products(CAS) of 1-methyl-4-((3-methylbut-2-en-1-yl)oxy)quinolin-2(1H)-one: 26126-76-1. |
| Q: What is the molecular weight of 1-methyl-4-((3-methylbut-2-en-1-yl)oxy)quinolin-2(1H)-one? |
| A: Molecular weight of 1-methyl-4-((3-methylbut-2-en-1-yl)oxy)quinolin-2(1H)-one is 228.286. |
| Q: What is the molecular formula of 1-methyl-4-((3-methylbut-2-en-1-yl)oxy)quinolin-2(1H)-one? |
| A: Molecular formula of 1-methyl-4-((3-methylbut-2-en-1-yl)oxy)quinolin-2(1H)-one is C15H17NO2. |
| Q: What is the polar surface area (PSA) of 1-methyl-4-((3-methylbut-2-en-1-yl)oxy)quinolin-2(1H)-one? |
| A: Polar surface area (PSA) of 1-methyl-4-((3-methylbut-2-en-1-yl)oxy)quinolin-2(1H)-one is 31.23000. |
| Q: What is the Chinese name of 20105-22-0? |
| A: Chinese name of 20105-22-0 is 20105-22-0. |
| Q: What is the LogP of 1-methyl-4-((3-methylbut-2-en-1-yl)oxy)quinolin-2(1H)-one? |
| A: LogP of 1-methyl-4-((3-methylbut-2-en-1-yl)oxy)quinolin-2(1H)-one is 3.81. |
| Q: What is the English name of 1-methyl-4-((3-methylbut-2-en-1-yl)oxy)quinolin-2(1H)-one? |
| A: The English name of 1-methyl-4-((3-methylbut-2-en-1-yl)oxy)quinolin-2(1H)-one is 1-methyl-4-((3-methylbut-2-en-1-yl)oxy)quinolin-2(1H)-one. |
| Q: What English synonyms does 1-methyl-4-((3-methylbut-2-en-1-yl)oxy)quinolin-2(1H)-one have? |
| A: English synonyms of 1-methyl-4-((3-methylbut-2-en-1-yl)oxy)quinolin-2(1H)-one: 4-[(3-Methyl-2-buten-1-yl)oxy]-2(1H)-naphthalenone. |
| Q: What is the InChIKey of 1-methyl-4-((3-methylbut-2-en-1-yl)oxy)quinolin-2(1H)-one? |
| A: InChIKey of 1-methyl-4-((3-methylbut-2-en-1-yl)oxy)quinolin-2(1H)-one is MADRTKVOWFLSFO-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 1-methyl-4-((3-methylbut-2-en-1-yl)oxy)quinolin-2(1H)-one? |
| A: SMILES notation of 1-methyl-4-((3-methylbut-2-en-1-yl)oxy)quinolin-2(1H)-one is CC(C)=CCOc1cc(=O)n(C)c2ccccc12. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| BioBioPha |
| naturewill |