4-tert-butyl-2-[(4-chlorophenyl)methyl]phenol structure
|
Common Name | 4-tert-butyl-2-[(4-chlorophenyl)methyl]phenol | ||
|---|---|---|---|---|
| CAS Number | 20121-09-9 | Molecular Weight | 274.78500 | |
| Density | 1.117g/cm3 | Boiling Point | 379.5ºC at 760 mmHg | |
| Molecular Formula | C17H19ClO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 183.3ºC | |
| Name | 4-tert-butyl-2-[(4-chlorophenyl)methyl]phenol |
|---|
| Density | 1.117g/cm3 |
|---|---|
| Boiling Point | 379.5ºC at 760 mmHg |
| Molecular Formula | C17H19ClO |
| Molecular Weight | 274.78500 |
| Flash Point | 183.3ºC |
| Exact Mass | 274.11200 |
| PSA | 20.23000 |
| LogP | 4.93390 |
| Vapour Pressure | 2.67E-06mmHg at 25°C |
| Index of Refraction | 1.57 |
| InChIKey | GMXYMQVEBDBUGZ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1ccc(O)c(Cc2ccc(Cl)cc2)c1 |
| HS Code | 2908199090 |
|---|
|
~%
4-tert-butyl-2-... CAS#:20121-09-9 |
| Literature: Buu-Hoi; Demerseman Journal of Organic Chemistry, 1955 , vol. 20, p. 1129,1131 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2908199090 |
|---|---|
| Summary | HS: 2908199090. derivatives of polyphenols or phenol-alcohols containing only halogen substituents and their salts. VAT:17.0%. tax rebate rate:9.0%. supervision conditions:None. MFN tariff:5.5%. general tariff:30.0% |