4-tert-butyl-2-[(tert-butylamino)methyl]phenol structure
|
Common Name | 4-tert-butyl-2-[(tert-butylamino)methyl]phenol | ||
|---|---|---|---|---|
| CAS Number | 7153-52-8 | Molecular Weight | 235.36500 | |
| Density | 0.957g/cm3 | Boiling Point | 321.8ºC at 760 mmHg | |
| Molecular Formula | C15H25NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 54.7ºC | |
| Name | 4-tert-butyl-2-[(tert-butylamino)methyl]phenol |
|---|
| Density | 0.957g/cm3 |
|---|---|
| Boiling Point | 321.8ºC at 760 mmHg |
| Molecular Formula | C15H25NO |
| Molecular Weight | 235.36500 |
| Flash Point | 54.7ºC |
| Exact Mass | 235.19400 |
| PSA | 32.26000 |
| LogP | 3.96870 |
| Index of Refraction | 1.51 |
| InChIKey | KZVDGCKVHOQOHP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)NCc1cc(C(C)(C)C)ccc1O |
|
~%
4-tert-butyl-2-... CAS#:7153-52-8 |
| Literature: Rohm and Haas Co. Patent: US2750416 , 1950 ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |