ethoxycarbonylsulfamoyl-triethyl-azanium structure
|
Common Name | ethoxycarbonylsulfamoyl-triethyl-azanium | ||
|---|---|---|---|---|
| CAS Number | 20133-49-7 | Molecular Weight | 253.33900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H21N2O4S+ | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | ethoxycarbonylsulfamoyl(triethyl)azanium |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C9H21N2O4S+ |
|---|---|
| Molecular Weight | 253.33900 |
| Exact Mass | 253.12200 |
| PSA | 80.85000 |
| LogP | 2.32550 |
| InChIKey | ANOSWSHWOQMDKR-UHFFFAOYSA-O |
| SMILES | CCOC(=O)NS(=O)(=O)[N+](CC)(CC)CC |
|
~%
ethoxycarbonyls... CAS#:20133-49-7 |
| Literature: Atkins,G.M.; Burgess,E.M. Journal of the American Chemical Society, 1972 , vol. 94, # 17 p. 6135 - 6141 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| Triethylammonium-N-ethoxycarbonyl-sulfonamidat |
| Et3NSO2NCO2Et |
| ethoxycarbonylsulfamoyl-triethyl-ammonium betaine |