Carbamic acid, (phenylsulfamoyl)-,ethyl ester (6CI,7CI) structure
|
Common Name | Carbamic acid, (phenylsulfamoyl)-,ethyl ester (6CI,7CI) | ||
|---|---|---|---|---|
| CAS Number | 90438-31-6 | Molecular Weight | 244.26800 | |
| Density | 1.393g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C9H12N2O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | ethyl N-(phenylsulfamoyl)carbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.393g/cm3 |
|---|---|
| Molecular Formula | C9H12N2O4S |
| Molecular Weight | 244.26800 |
| Exact Mass | 244.05200 |
| PSA | 92.88000 |
| LogP | 2.63410 |
| Index of Refraction | 1.583 |
| InChIKey | JJNNOOVVEYDNLR-UHFFFAOYSA-N |
| SMILES | CCOC(=O)NS(=O)(=O)Nc1ccccc1 |
|
~%
Carbamic acid, ... CAS#:90438-31-6 |
| Literature: Atkins,G.M.; Burgess,E.M. Journal of the American Chemical Society, 1968 , vol. 90, p. 4744 - 4745 |
|
~%
Carbamic acid, ... CAS#:90438-31-6 |
| Literature: Graf,R. Chemische Berichte, 1963 , vol. 96, p. 56 - 67 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| phenylsulfamoyl-carbamic acid ethyl ester |
| Carbamidsaeure-aethylester-N-sulfanilid |
| N-Ethoxycarbonyl-N'-phenyl-sulfamid |
| Phenylsulfamoyl-carbamidsaeure-aethylester |