N-(3-Chloro-o-tolyl)-3-oxobutyramide structure
|
Common Name | N-(3-Chloro-o-tolyl)-3-oxobutyramide | ||
|---|---|---|---|---|
| CAS Number | 20139-54-2 | Molecular Weight | 225.67100 | |
| Density | 1.247g/cm3 | Boiling Point | 384ºC at 760 mmHg | |
| Molecular Formula | C11H12ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 186ºC | |
| Name | N-(3-chloro-2-methylphenyl)-3-oxobutanamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.247g/cm3 |
|---|---|
| Boiling Point | 384ºC at 760 mmHg |
| Molecular Formula | C11H12ClNO2 |
| Molecular Weight | 225.67100 |
| Flash Point | 186ºC |
| Exact Mass | 225.05600 |
| PSA | 46.17000 |
| LogP | 2.63900 |
| Vapour Pressure | 4.23E-06mmHg at 25°C |
| Index of Refraction | 1.572 |
| InChIKey | NBLAONBKZUTBFR-UHFFFAOYSA-N |
| SMILES | CC(=O)CC(=O)Nc1cccc(Cl)c1C |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 3'-Chloro-ortho-acetoacetotoluidide |
| N-(3-chloro-o-tolyl)-3-oxobutyramide |