5'-Chloro-3-hydroxy-2'-methyl-2-naphthanilide structure
|
Common Name | 5'-Chloro-3-hydroxy-2'-methyl-2-naphthanilide | ||
|---|---|---|---|---|
| CAS Number | 135-63-7 | Molecular Weight | 311.76200 | |
| Density | 1.36 g/cm3 | Boiling Point | 423.8ºC at 760 mmHg | |
| Molecular Formula | C18H14ClNO2 | Melting Point | 244 °C | |
| MSDS | N/A | Flash Point | 210.1ºC | |
| Name | N-(5-Chloro-2-methylphenyl)-3-hydroxynaphthalene-2-carboxamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.36 g/cm3 |
|---|---|
| Boiling Point | 423.8ºC at 760 mmHg |
| Melting Point | 244 °C |
| Molecular Formula | C18H14ClNO2 |
| Molecular Weight | 311.76200 |
| Flash Point | 210.1ºC |
| Exact Mass | 311.07100 |
| PSA | 49.33000 |
| LogP | 4.83250 |
| Vapour Pressure | 8.77E-08mmHg at 25°C |
| Index of Refraction | 1.717 |
| InChIKey | XZOACPDZZYNJER-UHFFFAOYSA-N |
| SMILES | Cc1ccc(Cl)cc1NC(=O)c1cc2ccccc2cc1O |
| Safety Phrases | S24/25 |
|---|---|
| WGK Germany | 1 |
| RTECS | NY1511500 |
| HS Code | 2924299090 |
|
~%
5'-Chloro-3-hyd... CAS#:135-63-7 |
| Literature: Analytical Chemistry, , vol. 66, # 8 p. 1347 - 1353 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 3-Hydroxy-[2]naphthoesaeure-(5-chlor-2-methyl-anilid) |
| 5'-Chloro-3-hydroxy-2'-Methyl-2-naphthanilide |
| Naphtol AS-KB |
| 3-hydroxy-[2]naphthoic acid-(5-chloro-2-methyl-anilide) |
| MFCD00021636 |
| Azoic Coupling Component 21 |
| 3-Hydroxy-naphthoesaeure-(2)-(5-chlor-2-methyl-anilid) |
| EINECS 205-207-1 |
| Naphthol AS-KB |
| 3-hydroxy-N-(5-chloro-2-tolyl)-2-naphthalenecarboxamide |
| 5'-Chloro-N-(3-hydroxy-2-naphthoyl)-o-toluidine |
| Acco Naphthol AS-KB |
| Naphtanilide KB |
| N-(5-Chloro-o-tolyl)-3-hydroxy-2-naphthamide |
| Naphthol AS-TR |
| Hiltonaphthol AS-KB |
| Naphtazol C |
| Naphthanilid KB |
| Acco Naf-Sol AS-KB |
| N-(5-Chloro-2-methylphenyl)-3-hydroxy-2-naphthamide |