1-(4-nitrophenyl)-2-pyridin-2-yl-ethanol structure
|
Common Name | 1-(4-nitrophenyl)-2-pyridin-2-yl-ethanol | ||
|---|---|---|---|---|
| CAS Number | 20151-01-3 | Molecular Weight | 244.24600 | |
| Density | 1.311g/cm3 | Boiling Point | 406.1ºC at 760 mmHg | |
| Molecular Formula | C13H12N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 199.4ºC | |
| Name | 1-(4-nitrophenyl)-2-pyridin-2-ylethanol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.311g/cm3 |
|---|---|
| Boiling Point | 406.1ºC at 760 mmHg |
| Molecular Formula | C13H12N2O3 |
| Molecular Weight | 244.24600 |
| Flash Point | 199.4ºC |
| Exact Mass | 244.08500 |
| PSA | 78.94000 |
| LogP | 2.78910 |
| Vapour Pressure | 2.53E-07mmHg at 25°C |
| Index of Refraction | 1.632 |
| InChIKey | ANXXWRWZWCRHSO-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(C(O)Cc2ccccn2)cc1 |
|
~89%
1-(4-nitropheny... CAS#:20151-01-3 |
| Literature: Mao, Dan; Hong, Gang; Wu, Shengying; Liu, Xin; Yu, Jianjun; Wang, Limin European Journal of Organic Chemistry, 2014 , vol. 2014, # 14 p. 3009 - 3019 |
| Precursor 2 | |
|---|---|
| DownStream 2 | |
| 1-(4-nitro-phenyl)-2-[2]pyridyl-ethanol |
| 1-(4-Nitro-phenyl)-2-[2]pyridyl-aethanol |
| 2-<2-Hydroxy-2-(p-nitrophenyl)ethyl>pyridine |
| 1-(4-nitro-phenyl)-2-pyridin-2-yl-ethanol |