4-Nitrobenzaldehyde structure
|
Common Name | 4-Nitrobenzaldehyde | ||
|---|---|---|---|---|
| CAS Number | 555-16-8 | Molecular Weight | 151.120 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 299.6±23.0 °C at 760 mmHg | |
| Molecular Formula | C7H5NO3 | Melting Point | 103-106 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 155.2±15.4 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 4-nitrobenzaldehyde |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 299.6±23.0 °C at 760 mmHg |
| Melting Point | 103-106 °C(lit.) |
| Molecular Formula | C7H5NO3 |
| Molecular Weight | 151.120 |
| Flash Point | 155.2±15.4 °C |
| Exact Mass | 151.026947 |
| PSA | 62.89000 |
| LogP | 1.56 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.618 |
| InChIKey | BXRFQSNOROATLV-UHFFFAOYSA-N |
| SMILES | O=Cc1ccc([N+](=O)[O-])cc1 |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
MUTATION DATA
|
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H317-H319 |
| Precautionary Statements | P280-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Faceshields;Gloves |
| Hazard Codes | Xi:Irritant |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36/37-S61-S24/25-S36/37/39 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 2 |
| RTECS | CU7350000 |
| HS Code | 2913000090 |
| Precursor 9 | |
|---|---|
| DownStream 10 | |
| HS Code | 2913000090 |
|---|---|
| Summary | HS: 2913000090 halogenated, sulphonated, nitrated or nitrosated derivatives of products of heading 2912 Educational tariff:17.0% Tax rebate rate:9.0% Regulatory conditions:none Most favored nation tariff:5.5% General tariff:30.0% |
|
Mechanistic Insight into the Yolk@Shell Transformation of MnO@Silica Nanospheres Incorporating Ni(2+) Ions toward a Colloidal Hollow Nanoreactor.
Small 11(16) , 1930-8, (2015) As an effort to develop a simple and versatile synthetic strategy that contributes to the evolution of hollow nanostructures with increasing complexity and functionality, this research is devoted to s... |
|
|
Novel styrylbenzene derivatives for detecting amyloid deposits.
Clin. Chim. Acta 436 , 27-34, (2014) Various styrylbenzene compounds were synthesized and evaluated as mainly Aβ amyloid sensors. These compounds, however, cannot be used for detecting amyloid deposition in peripheral nerves because of t... |
|
|
Application of 1-(2-pyridylazo)-2-naphthol-modified nanoporous silica as a technique in simultaneous trace monitoring and removal of toxic heavy metals in food and water samples.
Environ. Monit. Assess. 187(1) , 4176, (2015) Solid-phase extraction is one the most useful and efficient techniques for sample preparation, purification, cleanup, preconcentration, and determination of heavy metals at trace levels. In this paper... |
| 4-FORMYLNITROBENZENE |
| 4-nitro-benzaldehyd |
| Benzaldehyde,4-nitro |
| 4-mononitrobenzaldehyde |
| 4-nitro-benzaldehyde |
| 4-nitrobenzaldehdye |
| MFCD00007346 |
| Benzaldehyde,p-nitro |
| p-nitro-benzaldehyd |
| P-NITROBENZALDEHYDE |
| Nitrobenzaldehyde |
| EINECS 209-084-5 |
| Benzaldehyde, 4-nitro- |
| Benzaldehyde, p-nitro- |
| WNR DVH |
| p-nitrobenzoic aldehyde |
| para-nitrobenzaldehyde |
| NITROBENZALDEHYDE 4 |
| p-Formylnitrobenzene |
| 4-Nitrobenzaldehyde |